C21H17F — CID 139875710
6-ethyl-1-fluoro-2-[2-(4-methylphenyl)ethynyl]naphthalene (PubChem CID 139875710) has the molecular formula C21H17F and a molecular weight of 288.37 g/mol. Its IUPAC name is 6-ethyl-1-fluoro-2-[2-(4-methylphenyl)ethynyl]naphthalene.
| Compound Name | 6-ethyl-1-fluoro-2-[2-(4-methylphenyl)ethynyl]naphthalene |
|---|---|
| PubChem CID | 139875710 |
| Molecular Formula | C21H17F |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 6-ethyl-1-fluoro-2-[2-(4-methylphenyl)ethynyl]naphthalene |
| SMILES | CCc1ccc2c(F)c(C#Cc3ccc(C)cc3)ccc2c1 |
| InChI | InChI=1S/C21H17F/c1-3-16-9-13-20-19(14-16)12-11-18(21(20)22)10-8-17-6-4-15(2)5-7-17/h4-7,9,11-14H,3H2,1-2H3 |
| InChIKey | AWVYUKLQWQUIRG-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|