C30H25F — CID 139875847
1-fluoro-2-[2-[4-(4-methylphenyl)phenyl]ethynyl]-6-[(E)-pent-3-enyl]naphthalene (PubChem CID 139875847) has the molecular formula C30H25F and a molecular weight of 404.53 g/mol. Its IUPAC name is 1-fluoro-2-[2-[4-(4-methylphenyl)phenyl]ethynyl]-6-[(E)-pent-3-enyl]naphthalene.
| Compound Name | 1-fluoro-2-[2-[4-(4-methylphenyl)phenyl]ethynyl]-6-[(E)-pent-3-enyl]naphthalene |
|---|---|
| PubChem CID | 139875847 |
| Molecular Formula | C30H25F |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 1-fluoro-2-[2-[4-(4-methylphenyl)phenyl]ethynyl]-6-[(E)-pent-3-enyl]naphthalene |
| SMILES | C/C=C/CCc1ccc2c(F)c(C#Cc3ccc(-c4ccc(C)cc4)cc3)ccc2c1 |
| InChI | InChI=1S/C30H25F/c1-3-4-5-6-24-12-20-29-28(21-24)19-18-27(30(29)31)17-11-23-9-15-26(16-10-23)25-13-7-22(2)8-14-25/h3-4,7-10,12-16,18-21H,5-6H2,1-2H3/b4-3+ |
| InChIKey | GZUOQBSFVXPBMF-ONEGZZNKSA-N |
| XLogP | 7.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|