C34H31F — CID 139876924
1-fluoro-2-[(E)-pent-3-enyl]-6-[2-[4-[4-[(E)-pent-3-enyl]phenyl]phenyl]ethynyl]naphthalene (PubChem CID 139876924) has the molecular formula C34H31F and a molecular weight of 458.62 g/mol. Its IUPAC name is 1-fluoro-2-[(E)-pent-3-enyl]-6-[2-[4-[4-[(E)-pent-3-enyl]phenyl]phenyl]ethynyl]naphthalene.
| Compound Name | 1-fluoro-2-[(E)-pent-3-enyl]-6-[2-[4-[4-[(E)-pent-3-enyl]phenyl]phenyl]ethynyl]naphthalene |
|---|---|
| PubChem CID | 139876924 |
| Molecular Formula | C34H31F |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 1-fluoro-2-[(E)-pent-3-enyl]-6-[2-[4-[4-[(E)-pent-3-enyl]phenyl]phenyl]ethynyl]naphthalene |
| SMILES | C/C=C/CCc1ccc(-c2ccc(C#Cc3ccc4c(F)c(CC/C=C/C)ccc4c3)cc2)cc1 |
| InChI | InChI=1S/C34H31F/c1-3-5-7-9-26-13-18-29(19-14-26)30-20-15-27(16-21-30)11-12-28-17-24-33-32(25-28)23-22-31(34(33)35)10-8-6-4-2/h3-6,13-25H,7-10H2,1-2H3/b5-3+,6-4+ |
| InChIKey | ZNTXKPIFYZKHFD-GGWOSOGESA-N |
| XLogP | 9.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|