C28H27F — CID 139875921
1-fluoro-2-[(E)-pent-3-enyl]-6-[2-[4-[(E)-pent-3-enyl]phenyl]ethynyl]naphthalene (PubChem CID 139875921) has the molecular formula C28H27F and a molecular weight of 382.52 g/mol. Its IUPAC name is 1-fluoro-2-[(E)-pent-3-enyl]-6-[2-[4-[(E)-pent-3-enyl]phenyl]ethynyl]naphthalene.
| Compound Name | 1-fluoro-2-[(E)-pent-3-enyl]-6-[2-[4-[(E)-pent-3-enyl]phenyl]ethynyl]naphthalene |
|---|---|
| PubChem CID | 139875921 |
| Molecular Formula | C28H27F |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 1-fluoro-2-[(E)-pent-3-enyl]-6-[2-[4-[(E)-pent-3-enyl]phenyl]ethynyl]naphthalene |
| SMILES | C/C=C/CCc1ccc(C#Cc2ccc3c(F)c(CC/C=C/C)ccc3c2)cc1 |
| InChI | InChI=1S/C28H27F/c1-3-5-7-9-22-11-13-23(14-12-22)15-16-24-17-20-27-26(21-24)19-18-25(28(27)29)10-8-6-4-2/h3-6,11-14,17-21H,7-10H2,1-2H3/b5-3+,6-4+ |
| InChIKey | GATFZMSXJCHXAA-GGWOSOGESA-N |
| XLogP | 7.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|