C32H25F5O — CID 139850681
1-fluoro-2-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]-6-[2-[4-[(E)-pent-3-enyl]phenyl]ethynyl]naphthalene (PubChem CID 139850681) has the molecular formula C32H25F5O and a molecular weight of 520.54 g/mol. Its IUPAC name is 1-fluoro-2-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]-6-[2-[4-[(E)-pent-3-enyl]phenyl]ethynyl]naphthalene.
| Compound Name | 1-fluoro-2-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]-6-[2-[4-[(E)-pent-3-enyl]phenyl]ethynyl]naphthalene |
|---|---|
| PubChem CID | 139850681 |
| Molecular Formula | C32H25F5O |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 1-fluoro-2-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]-6-[2-[4-[(E)-pent-3-enyl]phenyl]ethynyl]naphthalene |
| SMILES | C/C=C/CCc1ccc(C#Cc2ccc3c(F)c(CCc4ccc(OC(F)(F)F)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C32H25F5O/c1-2-3-4-5-22-6-8-23(9-7-22)10-11-24-13-18-28-27(20-24)17-16-26(31(28)34)15-12-25-14-19-30(29(33)21-25)38-32(35,36)37/h2-3,6-9,13-14,16-21H,4-5,12,15H2,1H3/b3-2+ |
| InChIKey | GQVGJKGAWYXAMA-NSCUHMNNSA-N |
| XLogP | 8.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|