C31H24F4 — CID 139856788
6-[2-[4-[2-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]ethyl]phenyl]ethynyl]-1,2-difluoronaphthalene (PubChem CID 139856788) has the molecular formula C31H24F4 and a molecular weight of 472.53 g/mol. Its IUPAC name is 6-[2-[4-[2-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]ethyl]phenyl]ethynyl]-1,2-difluoronaphthalene.
| Compound Name | 6-[2-[4-[2-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]ethyl]phenyl]ethynyl]-1,2-difluoronaphthalene |
|---|---|
| PubChem CID | 139856788 |
| Molecular Formula | C31H24F4 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 6-[2-[4-[2-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]ethyl]phenyl]ethynyl]-1,2-difluoronaphthalene |
| SMILES | C/C=C/CCc1cc(F)c(CCc2ccc(C#Cc3ccc4c(F)c(F)ccc4c3)cc2)c(F)c1 |
| InChI | InChI=1S/C31H24F4/c1-2-3-4-5-24-19-29(33)27(30(34)20-24)16-12-22-8-6-21(7-9-22)10-11-23-13-15-26-25(18-23)14-17-28(32)31(26)35/h2-3,6-9,13-15,17-20H,4-5,12,16H2,1H3/b3-2+ |
| InChIKey | DZTUFOUGFIZIAU-NSCUHMNNSA-N |
| XLogP | 8.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|