C29H22F4N2 — CID 139858547
2-[2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]ethyl]-5-[(E)-pent-3-enyl]pyrimidine (PubChem CID 139858547) has the molecular formula C29H22F4N2 and a molecular weight of 474.50 g/mol. Its IUPAC name is 2-[2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]ethyl]-5-[(E)-pent-3-enyl]pyrimidine.
| Compound Name | 2-[2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]ethyl]-5-[(E)-pent-3-enyl]pyrimidine |
|---|---|
| PubChem CID | 139858547 |
| Molecular Formula | C29H22F4N2 |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 2-[2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]ethyl]-5-[(E)-pent-3-enyl]pyrimidine |
| SMILES | C/C=C/CCc1cnc(CCc2cc(F)c(C#Cc3ccc4c(F)c(F)ccc4c3)c(F)c2)nc1 |
| InChI | InChI=1S/C29H22F4N2/c1-2-3-4-5-21-17-34-28(35-18-21)13-8-20-15-26(31)24(27(32)16-20)11-7-19-6-10-23-22(14-19)9-12-25(30)29(23)33/h2-3,6,9-10,12,14-18H,4-5,8,13H2,1H3/b3-2+ |
| InChIKey | FOKAMZKJIKCNLE-NSCUHMNNSA-N |
| XLogP | 6.88 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|