C27H17F4N — CID 139857993
5-but-3-enyl-2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]pyridine (PubChem CID 139857993) has the molecular formula C27H17F4N and a molecular weight of 431.43 g/mol. Its IUPAC name is 5-but-3-enyl-2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]pyridine.
| Compound Name | 5-but-3-enyl-2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]pyridine |
|---|---|
| PubChem CID | 139857993 |
| Molecular Formula | C27H17F4N |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 5-but-3-enyl-2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]pyridine |
| SMILES | C=CCCc1ccc(-c2cc(F)c(C#Cc3ccc4c(F)c(F)ccc4c3)c(F)c2)nc1 |
| InChI | InChI=1S/C27H17F4N/c1-2-3-4-18-7-12-26(32-16-18)20-14-24(29)22(25(30)15-20)10-6-17-5-9-21-19(13-17)8-11-23(28)27(21)31/h2,5,7-9,11-16H,1,3-4H2 |
| InChIKey | VMBIHLBSRFEWOV-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|