C29H15F5O — CID 139859097
6-[2-[4-[2-(2,6-difluoro-4-prop-2-enoxyphenyl)ethynyl]-2-fluorophenyl]ethynyl]-1,2-difluoronaphthalene (PubChem CID 139859097) has the molecular formula C29H15F5O and a molecular weight of 474.43 g/mol. Its IUPAC name is 6-[2-[4-[2-(2,6-difluoro-4-prop-2-enoxyphenyl)ethynyl]-2-fluorophenyl]ethynyl]-1,2-difluoronaphthalene.
| Compound Name | 6-[2-[4-[2-(2,6-difluoro-4-prop-2-enoxyphenyl)ethynyl]-2-fluorophenyl]ethynyl]-1,2-difluoronaphthalene |
|---|---|
| PubChem CID | 139859097 |
| Molecular Formula | C29H15F5O |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 6-[2-[4-[2-(2,6-difluoro-4-prop-2-enoxyphenyl)ethynyl]-2-fluorophenyl]ethynyl]-1,2-difluoronaphthalene |
| SMILES | C=CCOc1cc(F)c(C#Cc2ccc(C#Cc3ccc4c(F)c(F)ccc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C29H15F5O/c1-2-13-35-22-16-27(32)24(28(33)17-22)11-6-19-4-8-20(26(31)15-19)7-3-18-5-10-23-21(14-18)9-12-25(30)29(23)34/h2,4-5,8-10,12,14-17H,1,13H2 |
| InChIKey | JOUCAGYLXIJYKR-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|