C30H22F4 — CID 139858190
6-[2-[4-[2-(4-but-3-enylphenyl)ethyl]-2,6-difluorophenyl]ethynyl]-1,2-difluoronaphthalene (PubChem CID 139858190) has the molecular formula C30H22F4 and a molecular weight of 458.50 g/mol. Its IUPAC name is 6-[2-[4-[2-(4-but-3-enylphenyl)ethyl]-2,6-difluorophenyl]ethynyl]-1,2-difluoronaphthalene.
| Compound Name | 6-[2-[4-[2-(4-but-3-enylphenyl)ethyl]-2,6-difluorophenyl]ethynyl]-1,2-difluoronaphthalene |
|---|---|
| PubChem CID | 139858190 |
| Molecular Formula | C30H22F4 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 6-[2-[4-[2-(4-but-3-enylphenyl)ethyl]-2,6-difluorophenyl]ethynyl]-1,2-difluoronaphthalene |
| SMILES | C=CCCc1ccc(CCc2cc(F)c(C#Cc3ccc4c(F)c(F)ccc4c3)c(F)c2)cc1 |
| InChI | InChI=1S/C30H22F4/c1-2-3-4-20-5-7-21(8-6-20)9-10-23-18-28(32)26(29(33)19-23)15-12-22-11-14-25-24(17-22)13-16-27(31)30(25)34/h2,5-8,11,13-14,16-19H,1,3-4,9-10H2 |
| InChIKey | ZQPTWEDHEHKRKX-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|