C29H26F4 — CID 139859598
6-[2-[2,6-difluoro-4-[2-(4-prop-2-enylcyclohexyl)ethyl]phenyl]ethynyl]-1,2-difluoronaphthalene (PubChem CID 139859598) has the molecular formula C29H26F4 and a molecular weight of 450.52 g/mol. Its IUPAC name is 6-[2-[2,6-difluoro-4-[2-(4-prop-2-enylcyclohexyl)ethyl]phenyl]ethynyl]-1,2-difluoronaphthalene.
| Compound Name | 6-[2-[2,6-difluoro-4-[2-(4-prop-2-enylcyclohexyl)ethyl]phenyl]ethynyl]-1,2-difluoronaphthalene |
|---|---|
| PubChem CID | 139859598 |
| Molecular Formula | C29H26F4 |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 6-[2-[2,6-difluoro-4-[2-(4-prop-2-enylcyclohexyl)ethyl]phenyl]ethynyl]-1,2-difluoronaphthalene |
| SMILES | C=CCC1CCC(CCc2cc(F)c(C#Cc3ccc4c(F)c(F)ccc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C29H26F4/c1-2-3-19-4-6-20(7-5-19)8-9-22-17-27(31)25(28(32)18-22)14-11-21-10-13-24-23(16-21)12-15-26(30)29(24)33/h2,10,12-13,15-20H,1,3-9H2 |
| InChIKey | IQZAIPXRHCQUHP-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|