C26H35F2N — CID 139901549
2,6-difluoro-4-[2-[4-[2-(4-prop-2-enylcyclohexyl)ethyl]cyclohexyl]ethyl]benzonitrile (PubChem CID 139901549) has the molecular formula C26H35F2N and a molecular weight of 399.57 g/mol. Its IUPAC name is 2,6-difluoro-4-[2-[4-[2-(4-prop-2-enylcyclohexyl)ethyl]cyclohexyl]ethyl]benzonitrile.
| Compound Name | 2,6-difluoro-4-[2-[4-[2-(4-prop-2-enylcyclohexyl)ethyl]cyclohexyl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 139901549 |
| Molecular Formula | C26H35F2N |
| Molecular Weight | 399.57 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | 2,6-difluoro-4-[2-[4-[2-(4-prop-2-enylcyclohexyl)ethyl]cyclohexyl]ethyl]benzonitrile |
| SMILES | C=CCC1CCC(CCC2CCC(CCc3cc(F)c(C#N)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C26H35F2N/c1-2-3-19-4-6-20(7-5-19)8-9-21-10-12-22(13-11-21)14-15-23-16-25(27)24(18-29)26(28)17-23/h2,16-17,19-22H,1,3-15H2 |
| InChIKey | KJWBEUBCFREIDC-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.57 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|