C28H39F2NO2 — CID 139901622
2,6-difluoro-4-[2-[4-[[4-(3-prop-2-enoxypropyl)cyclohexyl]oxymethyl]cyclohexyl]ethyl]benzonitrile (PubChem CID 139901622) has the molecular formula C28H39F2NO2 and a molecular weight of 459.62 g/mol. Its IUPAC name is 2,6-difluoro-4-[2-[4-[[4-(3-prop-2-enoxypropyl)cyclohexyl]oxymethyl]cyclohexyl]ethyl]benzonitrile.
| Compound Name | 2,6-difluoro-4-[2-[4-[[4-(3-prop-2-enoxypropyl)cyclohexyl]oxymethyl]cyclohexyl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 139901622 |
| Molecular Formula | C28H39F2NO2 |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | 2,6-difluoro-4-[2-[4-[[4-(3-prop-2-enoxypropyl)cyclohexyl]oxymethyl]cyclohexyl]ethyl]benzonitrile |
| SMILES | C=CCOCCCC1CCC(OCC2CCC(CCc3cc(F)c(C#N)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C28H39F2NO2/c1-2-15-32-16-3-4-21-11-13-25(14-12-21)33-20-23-8-5-22(6-9-23)7-10-24-17-27(29)26(19-31)28(30)18-24/h2,17-18,21-23,25H,1,3-16,20H2 |
| InChIKey | DJNVXFBIIZMEQV-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|