C20H25F2NO — CID 139901548
2,6-difluoro-4-[2-[4-(2-prop-2-enoxyethyl)cyclohexyl]ethyl]benzonitrile (PubChem CID 139901548) has the molecular formula C20H25F2NO and a molecular weight of 333.42 g/mol. Its IUPAC name is 2,6-difluoro-4-[2-[4-(2-prop-2-enoxyethyl)cyclohexyl]ethyl]benzonitrile.
| Compound Name | 2,6-difluoro-4-[2-[4-(2-prop-2-enoxyethyl)cyclohexyl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 139901548 |
| Molecular Formula | C20H25F2NO |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 2,6-difluoro-4-[2-[4-(2-prop-2-enoxyethyl)cyclohexyl]ethyl]benzonitrile |
| SMILES | C=CCOCCC1CCC(CCc2cc(F)c(C#N)c(F)c2)CC1 |
| InChI | InChI=1S/C20H25F2NO/c1-2-10-24-11-9-16-5-3-15(4-6-16)7-8-17-12-19(21)18(14-23)20(22)13-17/h2,12-13,15-16H,1,3-11H2 |
| InChIKey | BEGZZBRYSJNBDD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|