C27H30F3N — CID 139901606
4-[2-[4-[2-(4-but-3-enylcyclohexyl)ethyl]-2-fluorophenyl]ethyl]-2,6-difluorobenzonitrile (PubChem CID 139901606) has the molecular formula C27H30F3N and a molecular weight of 425.54 g/mol. Its IUPAC name is 4-[2-[4-[2-(4-but-3-enylcyclohexyl)ethyl]-2-fluorophenyl]ethyl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[2-[4-[2-(4-but-3-enylcyclohexyl)ethyl]-2-fluorophenyl]ethyl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 139901606 |
| Molecular Formula | C27H30F3N |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 4-[2-[4-[2-(4-but-3-enylcyclohexyl)ethyl]-2-fluorophenyl]ethyl]-2,6-difluorobenzonitrile |
| SMILES | C=CCCC1CCC(CCc2ccc(CCc3cc(F)c(C#N)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C27H30F3N/c1-2-3-4-19-5-7-20(8-6-19)9-10-21-11-13-23(25(28)15-21)14-12-22-16-26(29)24(18-31)27(30)17-22/h2,11,13,15-17,19-20H,1,3-10,12,14H2 |
| InChIKey | UPZIAMNXLMKYRA-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|