About (Z)-5-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-2-fluoropent-2-enenitrile
(Z)-5-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-2-fluoropent-2-enenitrile (PubChem CID 67589613) has the molecular formula C19H22F3N
and a molecular weight of 321.39 g/mol. Its IUPAC name is (Z)-5-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-2-fluoropent-2-enenitrile.
Molecular Properties
| Compound Name | (Z)-5-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-2-fluoropent-2-enenitrile |
| PubChem CID | 67589613 |
| Molecular Formula | C19H22F3N |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (Z)-5-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-2-fluoropent-2-enenitrile |
| SMILES | N#C/C(F)=C/CCC1CCC(CCc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H22F3N/c20-17(13-23)3-1-2-14-4-6-15(7-5-14)8-9-16-10-11-18(21)19(22)12-16/h3,10-12,14-15H,1-2,4-9H2/b17-3- |
| InChIKey | IFKMICBCXYOFHR-YPEHOIGNSA-N |
| XLogP | 5.86 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-2-fluoropent-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-2-fluoropent-2-enenitrile?
The IUPAC name of (Z)-5-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-2-fluoropent-2-enenitrile (CID 67589613) is (Z)-5-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-2-fluoropent-2-enenitrile.
What is the SMILES notation for (Z)-5-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-2-fluoropent-2-enenitrile?
The canonical SMILES for (Z)-5-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-2-fluoropent-2-enenitrile is N#C/C(F)=C/CCC1CCC(CCc2ccc(F)c(F)c2)CC1.
What is the InChIKey of (Z)-5-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-2-fluoropent-2-enenitrile?
The InChIKey is IFKMICBCXYOFHR-YPEHOIGNSA-N. The full InChI is InChI=1S/C19H22F3N/c20-17(13-23)3-1-2-14-4-6-15(7-5-14)8-9-16-10-11-18(21)19(22)12-16/h3,10-12,14-15H,1-2,4-9H2/b17-3-.
What are the key properties of (Z)-5-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-2-fluoropent-2-enenitrile?
(Z)-5-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-2-fluoropent-2-enenitrile has a molecular weight of 321.39 g/mol, XLogP of 5.86, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-2-fluoropent-2-enenitrile is sourced from PubChem (CID 67589613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).