C29H40FN — CID 67589751
5-[4-[(E)-2-[4-(4-butylphenyl)cyclohexyl]ethenyl]cyclohexyl]-2-fluoropent-2-enenitrile (PubChem CID 67589751) has the molecular formula C29H40FN and a molecular weight of 421.64 g/mol. Its IUPAC name is 5-[4-[(E)-2-[4-(4-butylphenyl)cyclohexyl]ethenyl]cyclohexyl]-2-fluoropent-2-enenitrile.
| Compound Name | 5-[4-[(E)-2-[4-(4-butylphenyl)cyclohexyl]ethenyl]cyclohexyl]-2-fluoropent-2-enenitrile |
|---|---|
| PubChem CID | 67589751 |
| Molecular Formula | C29H40FN |
| Molecular Weight | 421.64 g/mol |
| Exact Mass | 421.31 |
| IUPAC Name | 5-[4-[(E)-2-[4-(4-butylphenyl)cyclohexyl]ethenyl]cyclohexyl]-2-fluoropent-2-enenitrile |
| SMILES | CCCCc1ccc(C2CCC(/C=C/C3CCC(CCC=C(F)C#N)CC3)CC2)cc1 |
| InChI | InChI=1S/C29H40FN/c1-2-3-5-23-14-18-27(19-15-23)28-20-16-26(17-21-28)13-12-25-10-8-24(9-11-25)6-4-7-29(30)22-31/h7,12-15,18-19,24-26,28H,2-6,8-11,16-17,20-21H2,1H3/b13-12+,29-7? |
| InChIKey | BFSDXHUWGPAYSV-LPBAMBJBSA-N |
| XLogP | 8.82 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.64 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|