C22H30FN — CID 19613074
(E)-2-fluoro-3-[4-(4-heptylphenyl)cyclohexyl]prop-2-enenitrile (PubChem CID 19613074) has the molecular formula C22H30FN and a molecular weight of 327.49 g/mol. Its IUPAC name is (E)-2-fluoro-3-[4-(4-heptylphenyl)cyclohexyl]prop-2-enenitrile.
| Compound Name | (E)-2-fluoro-3-[4-(4-heptylphenyl)cyclohexyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 19613074 |
| Molecular Formula | C22H30FN |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | (E)-2-fluoro-3-[4-(4-heptylphenyl)cyclohexyl]prop-2-enenitrile |
| SMILES | CCCCCCCc1ccc(C2CCC(/C=C(/F)C#N)CC2)cc1 |
| InChI | InChI=1S/C22H30FN/c1-2-3-4-5-6-7-18-8-12-20(13-9-18)21-14-10-19(11-15-21)16-22(23)17-24/h8-9,12-13,16,19,21H,2-7,10-11,14-15H2,1H3/b22-16+ |
| InChIKey | DTCGLIASMUPOSB-CJLVFECKSA-N |
| XLogP | 6.85 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|