C27H38FNO — CID 19613344
(E)-2-fluoro-3-[4-[[4-(4-pentylphenyl)cyclohexyl]oxymethyl]cyclohexyl]prop-2-enenitrile (PubChem CID 19613344) has the molecular formula C27H38FNO and a molecular weight of 411.61 g/mol. Its IUPAC name is (E)-2-fluoro-3-[4-[[4-(4-pentylphenyl)cyclohexyl]oxymethyl]cyclohexyl]prop-2-enenitrile.
| Compound Name | (E)-2-fluoro-3-[4-[[4-(4-pentylphenyl)cyclohexyl]oxymethyl]cyclohexyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 19613344 |
| Molecular Formula | C27H38FNO |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | (E)-2-fluoro-3-[4-[[4-(4-pentylphenyl)cyclohexyl]oxymethyl]cyclohexyl]prop-2-enenitrile |
| SMILES | CCCCCc1ccc(C2CCC(OCC3CCC(/C=C(/F)C#N)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H38FNO/c1-2-3-4-5-21-10-12-24(13-11-21)25-14-16-27(17-15-25)30-20-23-8-6-22(7-9-23)18-26(28)19-29/h10-13,18,22-23,25,27H,2-9,14-17,20H2,1H3/b26-18+ |
| InChIKey | JQRNSRJHNJMWPC-NLRVBDNBSA-N |
| XLogP | 7.65 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|