C27H36FNO2 — CID 54000206
[4-(4-pentylphenyl)cyclohexyl] 4-(2-cyano-2-fluoroethenyl)cyclohexane-1-carboxylate (PubChem CID 54000206) has the molecular formula C27H36FNO2 and a molecular weight of 425.59 g/mol. Its IUPAC name is [4-(4-pentylphenyl)cyclohexyl] 4-(2-cyano-2-fluoroethenyl)cyclohexane-1-carboxylate.
| Compound Name | [4-(4-pentylphenyl)cyclohexyl] 4-(2-cyano-2-fluoroethenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54000206 |
| Molecular Formula | C27H36FNO2 |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | [4-(4-pentylphenyl)cyclohexyl] 4-(2-cyano-2-fluoroethenyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCc1ccc(C2CCC(OC(=O)C3CCC(C=C(F)C#N)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H36FNO2/c1-2-3-4-5-20-6-10-22(11-7-20)23-14-16-26(17-15-23)31-27(30)24-12-8-21(9-13-24)18-25(28)19-29/h6-7,10-11,18,21,23-24,26H,2-5,8-9,12-17H2,1H3 |
| InChIKey | KLAIFECJNRRVMZ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|