C30H41NO2 — CID 54064068
[4-(4-hexylphenyl)cyclohexyl] 4-(4-cyanobuta-1,3-dienyl)cyclohexane-1-carboxylate (PubChem CID 54064068) has the molecular formula C30H41NO2 and a molecular weight of 447.66 g/mol. Its IUPAC name is [4-(4-hexylphenyl)cyclohexyl] 4-(4-cyanobuta-1,3-dienyl)cyclohexane-1-carboxylate.
| Compound Name | [4-(4-hexylphenyl)cyclohexyl] 4-(4-cyanobuta-1,3-dienyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54064068 |
| Molecular Formula | C30H41NO2 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | [4-(4-hexylphenyl)cyclohexyl] 4-(4-cyanobuta-1,3-dienyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCc1ccc(C2CCC(OC(=O)C3CCC(C=CC=CC#N)CC3)CC2)cc1 |
| InChI | InChI=1S/C30H41NO2/c1-2-3-4-6-9-24-11-15-26(16-12-24)27-19-21-29(22-20-27)33-30(32)28-17-13-25(14-18-28)10-7-5-8-23-31/h5,7-8,10-12,15-16,25,27-29H,2-4,6,9,13-14,17-22H2,1H3 |
| InChIKey | MBSQDNRMTLYPPJ-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|