C26H35NO2 — CID 18394000
[4-[(E)-2-cyanoethenyl]cyclohexyl] 4-(4-butylphenyl)cyclohexane-1-carboxylate (PubChem CID 18394000) has the molecular formula C26H35NO2 and a molecular weight of 393.57 g/mol. Its IUPAC name is [4-[(E)-2-cyanoethenyl]cyclohexyl] 4-(4-butylphenyl)cyclohexane-1-carboxylate.
| Compound Name | [4-[(E)-2-cyanoethenyl]cyclohexyl] 4-(4-butylphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18394000 |
| Molecular Formula | C26H35NO2 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | [4-[(E)-2-cyanoethenyl]cyclohexyl] 4-(4-butylphenyl)cyclohexane-1-carboxylate |
| SMILES | CCCCc1ccc(C2CCC(C(=O)OC3CCC(/C=C/C#N)CC3)CC2)cc1 |
| InChI | InChI=1S/C26H35NO2/c1-2-3-5-20-7-11-22(12-8-20)23-13-15-24(16-14-23)26(28)29-25-17-9-21(10-18-25)6-4-19-27/h4,6-8,11-12,21,23-25H,2-3,5,9-10,13-18H2,1H3/b6-4+ |
| InChIKey | JBYPUHKEXZCAEQ-GQCTYLIASA-N |
| XLogP | 6.48 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|