C29H41NO2 — CID 18394061
[4-[(E)-4-cyanobut-3-enyl]cyclohexyl] 4-(4-pentylphenyl)cyclohexane-1-carboxylate (PubChem CID 18394061) has the molecular formula C29H41NO2 and a molecular weight of 435.65 g/mol. Its IUPAC name is [4-[(E)-4-cyanobut-3-enyl]cyclohexyl] 4-(4-pentylphenyl)cyclohexane-1-carboxylate.
| Compound Name | [4-[(E)-4-cyanobut-3-enyl]cyclohexyl] 4-(4-pentylphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18394061 |
| Molecular Formula | C29H41NO2 |
| Molecular Weight | 435.65 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | [4-[(E)-4-cyanobut-3-enyl]cyclohexyl] 4-(4-pentylphenyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCc1ccc(C2CCC(C(=O)OC3CCC(CC/C=C/C#N)CC3)CC2)cc1 |
| InChI | InChI=1S/C29H41NO2/c1-2-3-5-8-23-10-14-25(15-11-23)26-16-18-27(19-17-26)29(31)32-28-20-12-24(13-21-28)9-6-4-7-22-30/h4,7,10-11,14-15,24,26-28H,2-3,5-6,8-9,12-13,16-21H2,1H3/b7-4+ |
| InChIKey | QNOYISDRXMMESB-QPJJXVBHSA-N |
| XLogP | 7.66 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.65 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|