C29H41N — CID 67590485
5-[4-[1-[4-(4-butylphenyl)cyclohexyl]ethenyl]cyclohexyl]pent-2-enenitrile (PubChem CID 67590485) has the molecular formula C29H41N and a molecular weight of 403.65 g/mol. Its IUPAC name is 5-[4-[1-[4-(4-butylphenyl)cyclohexyl]ethenyl]cyclohexyl]pent-2-enenitrile.
| Compound Name | 5-[4-[1-[4-(4-butylphenyl)cyclohexyl]ethenyl]cyclohexyl]pent-2-enenitrile |
|---|---|
| PubChem CID | 67590485 |
| Molecular Formula | C29H41N |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 403.32 |
| IUPAC Name | 5-[4-[1-[4-(4-butylphenyl)cyclohexyl]ethenyl]cyclohexyl]pent-2-enenitrile |
| SMILES | C=C(C1CCC(CCC=CC#N)CC1)C1CCC(c2ccc(CCCC)cc2)CC1 |
| InChI | InChI=1S/C29H41N/c1-3-4-8-24-12-16-28(17-13-24)29-20-18-27(19-21-29)23(2)26-14-10-25(11-15-26)9-6-5-7-22-30/h5,7,12-13,16-17,25-27,29H,2-4,6,8-11,14-15,18-21H2,1H3 |
| InChIKey | CUJWPLRXDVIXMJ-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|