C26H43N — CID 19613657
(E)-5-[4-[1-(4-heptylcyclohexyl)ethenyl]cyclohexyl]pent-2-enenitrile (PubChem CID 19613657) has the molecular formula C26H43N and a molecular weight of 369.64 g/mol. Its IUPAC name is (E)-5-[4-[1-(4-heptylcyclohexyl)ethenyl]cyclohexyl]pent-2-enenitrile.
| Compound Name | (E)-5-[4-[1-(4-heptylcyclohexyl)ethenyl]cyclohexyl]pent-2-enenitrile |
|---|---|
| PubChem CID | 19613657 |
| Molecular Formula | C26H43N |
| Molecular Weight | 369.64 g/mol |
| Exact Mass | 369.34 |
| IUPAC Name | (E)-5-[4-[1-(4-heptylcyclohexyl)ethenyl]cyclohexyl]pent-2-enenitrile |
| SMILES | C=C(C1CCC(CC/C=C/C#N)CC1)C1CCC(CCCCCCC)CC1 |
| InChI | InChI=1S/C26H43N/c1-3-4-5-6-8-11-23-13-17-25(18-14-23)22(2)26-19-15-24(16-20-26)12-9-7-10-21-27/h7,10,23-26H,2-6,8-9,11-20H2,1H3/b10-7+ |
| InChIKey | STCIEAIBDQETMM-JXMROGBWSA-N |
| XLogP | 8.38 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.64 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|