C28H44FN — CID 173304489
2-fluoro-7-[4-[1-(4-heptylcyclohexyl)ethenyl]cyclohexyl]hepta-2,4-dienenitrile (PubChem CID 173304489) has the molecular formula C28H44FN and a molecular weight of 413.67 g/mol. Its IUPAC name is 2-fluoro-7-[4-[1-(4-heptylcyclohexyl)ethenyl]cyclohexyl]hepta-2,4-dienenitrile.
| Compound Name | 2-fluoro-7-[4-[1-(4-heptylcyclohexyl)ethenyl]cyclohexyl]hepta-2,4-dienenitrile |
|---|---|
| PubChem CID | 173304489 |
| Molecular Formula | C28H44FN |
| Molecular Weight | 413.67 g/mol |
| Exact Mass | 413.35 |
| IUPAC Name | 2-fluoro-7-[4-[1-(4-heptylcyclohexyl)ethenyl]cyclohexyl]hepta-2,4-dienenitrile |
| SMILES | C=C(C1CCC(CCC=CC=C(F)C#N)CC1)C1CCC(CCCCCCC)CC1 |
| InChI | InChI=1S/C28H44FN/c1-3-4-5-6-8-11-24-14-18-26(19-15-24)23(2)27-20-16-25(17-21-27)12-9-7-10-13-28(29)22-30/h7,10,13,24-27H,2-6,8-9,11-12,14-21H2,1H3 |
| InChIKey | KUMIKKIOWSIESE-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.67 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|