C23H34FN — CID 173304309
5-[4-[1-(4-butylcyclohexyl)ethenyl]cyclohexyl]-2-fluoropenta-2,4-dienenitrile (PubChem CID 173304309) has the molecular formula C23H34FN and a molecular weight of 343.53 g/mol. Its IUPAC name is 5-[4-[1-(4-butylcyclohexyl)ethenyl]cyclohexyl]-2-fluoropenta-2,4-dienenitrile.
| Compound Name | 5-[4-[1-(4-butylcyclohexyl)ethenyl]cyclohexyl]-2-fluoropenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 173304309 |
| Molecular Formula | C23H34FN |
| Molecular Weight | 343.53 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | 5-[4-[1-(4-butylcyclohexyl)ethenyl]cyclohexyl]-2-fluoropenta-2,4-dienenitrile |
| SMILES | C=C(C1CCC(C=CC=C(F)C#N)CC1)C1CCC(CCCC)CC1 |
| InChI | InChI=1S/C23H34FN/c1-3-4-6-19-9-13-21(14-10-19)18(2)22-15-11-20(12-16-22)7-5-8-23(24)17-25/h5,7-8,19-22H,2-4,6,9-16H2,1H3 |
| InChIKey | NUWHVJGZTFWVBA-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.53 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|