C21H32FNO — CID 54229419
2-fluoro-5-[4-[(4-propylcyclohexyl)methoxy]cyclohexyl]penta-2,4-dienenitrile (PubChem CID 54229419) has the molecular formula C21H32FNO and a molecular weight of 333.49 g/mol. Its IUPAC name is 2-fluoro-5-[4-[(4-propylcyclohexyl)methoxy]cyclohexyl]penta-2,4-dienenitrile.
| Compound Name | 2-fluoro-5-[4-[(4-propylcyclohexyl)methoxy]cyclohexyl]penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 54229419 |
| Molecular Formula | C21H32FNO |
| Molecular Weight | 333.49 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | 2-fluoro-5-[4-[(4-propylcyclohexyl)methoxy]cyclohexyl]penta-2,4-dienenitrile |
| SMILES | CCCC1CCC(COC2CCC(C=CC=C(F)C#N)CC2)CC1 |
| InChI | InChI=1S/C21H32FNO/c1-2-4-17-7-9-19(10-8-17)16-24-21-13-11-18(12-14-21)5-3-6-20(22)15-23/h3,5-6,17-19,21H,2,4,7-14,16H2,1H3 |
| InChIKey | QIEKCDQWUWNORM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.49 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|