C21H35NO — CID 54255685
3-[4-[(4-pentylcyclohexyl)methoxy]cyclohexyl]prop-2-enenitrile (PubChem CID 54255685) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is 3-[4-[(4-pentylcyclohexyl)methoxy]cyclohexyl]prop-2-enenitrile.
| Compound Name | 3-[4-[(4-pentylcyclohexyl)methoxy]cyclohexyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 54255685 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | 3-[4-[(4-pentylcyclohexyl)methoxy]cyclohexyl]prop-2-enenitrile |
| SMILES | CCCCCC1CCC(COC2CCC(C=CC#N)CC2)CC1 |
| InChI | InChI=1S/C21H35NO/c1-2-3-4-6-18-8-10-20(11-9-18)17-23-21-14-12-19(13-15-21)7-5-16-22/h5,7,18-21H,2-4,6,8-15,17H2,1H3 |
| InChIKey | QZXCAHIUZNMYFE-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|