C12H19N — CID 54536266
3-(4-propylcyclohexyl)prop-2-enenitrile (PubChem CID 54536266) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 3-(4-propylcyclohexyl)prop-2-enenitrile.
| Compound Name | 3-(4-propylcyclohexyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 54536266 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 3-(4-propylcyclohexyl)prop-2-enenitrile |
| SMILES | CCCC1CCC(C=CC#N)CC1 |
| InChI | InChI=1S/C12H19N/c1-2-4-11-6-8-12(9-7-11)5-3-10-13/h3,5,11-12H,2,4,6-9H2,1H3 |
| InChIKey | YZZLKJFYICLVBC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|