C20H30FN — CID 54223857
2-fluoro-3-[4-[2-(4-propylcyclohexyl)ethenyl]cyclohexyl]prop-2-enenitrile (PubChem CID 54223857) has the molecular formula C20H30FN and a molecular weight of 303.47 g/mol. Its IUPAC name is 2-fluoro-3-[4-[2-(4-propylcyclohexyl)ethenyl]cyclohexyl]prop-2-enenitrile.
| Compound Name | 2-fluoro-3-[4-[2-(4-propylcyclohexyl)ethenyl]cyclohexyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 54223857 |
| Molecular Formula | C20H30FN |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | 2-fluoro-3-[4-[2-(4-propylcyclohexyl)ethenyl]cyclohexyl]prop-2-enenitrile |
| SMILES | CCCC1CCC(C=CC2CCC(C=C(F)C#N)CC2)CC1 |
| InChI | InChI=1S/C20H30FN/c1-2-3-16-4-6-17(7-5-16)8-9-18-10-12-19(13-11-18)14-20(21)15-22/h8-9,14,16-19H,2-7,10-13H2,1H3 |
| InChIKey | QEMKBDDGASSJJX-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|