C23H28F3N — CID 67589703
(Z)-3-[4-[2-[4-(3,4-difluorophenyl)cyclohexyl]ethyl]cyclohexyl]-2-fluoroprop-2-enenitrile (PubChem CID 67589703) has the molecular formula C23H28F3N and a molecular weight of 375.48 g/mol. Its IUPAC name is (Z)-3-[4-[2-[4-(3,4-difluorophenyl)cyclohexyl]ethyl]cyclohexyl]-2-fluoroprop-2-enenitrile.
| Compound Name | (Z)-3-[4-[2-[4-(3,4-difluorophenyl)cyclohexyl]ethyl]cyclohexyl]-2-fluoroprop-2-enenitrile |
|---|---|
| PubChem CID | 67589703 |
| Molecular Formula | C23H28F3N |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (Z)-3-[4-[2-[4-(3,4-difluorophenyl)cyclohexyl]ethyl]cyclohexyl]-2-fluoroprop-2-enenitrile |
| SMILES | N#C/C(F)=C/C1CCC(CCC2CCC(c3ccc(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C23H28F3N/c24-21(15-27)13-18-5-3-16(4-6-18)1-2-17-7-9-19(10-8-17)20-11-12-22(25)23(26)14-20/h11-14,16-19H,1-10H2/b21-13- |
| InChIKey | CYXSUMAJGQFTBG-BKUYFWCQSA-N |
| XLogP | 7.20 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|