C22H25FN2 — CID 54128510
4-[4-[4-(2-cyano-2-fluoroethenyl)cyclohexyl]cyclohexyl]benzonitrile (PubChem CID 54128510) has the molecular formula C22H25FN2 and a molecular weight of 336.45 g/mol. Its IUPAC name is 4-[4-[4-(2-cyano-2-fluoroethenyl)cyclohexyl]cyclohexyl]benzonitrile.
| Compound Name | 4-[4-[4-(2-cyano-2-fluoroethenyl)cyclohexyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 54128510 |
| Molecular Formula | C22H25FN2 |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 4-[4-[4-(2-cyano-2-fluoroethenyl)cyclohexyl]cyclohexyl]benzonitrile |
| SMILES | N#CC(F)=CC1CCC(C2CCC(c3ccc(C#N)cc3)CC2)CC1 |
| InChI | InChI=1S/C22H25FN2/c23-22(15-25)13-16-1-5-18(6-2-16)20-9-11-21(12-10-20)19-7-3-17(14-24)4-8-19/h3-4,7-8,13,16,18,20-21H,1-2,5-6,9-12H2 |
| InChIKey | NSQLIHSKMCMOLA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|