C21H26FN — CID 19798791
4-[4-[4-[(E)-2-fluoroethenyl]cyclohexyl]cyclohexyl]benzonitrile (PubChem CID 19798791) has the molecular formula C21H26FN and a molecular weight of 311.44 g/mol. Its IUPAC name is 4-[4-[4-[(E)-2-fluoroethenyl]cyclohexyl]cyclohexyl]benzonitrile.
| Compound Name | 4-[4-[4-[(E)-2-fluoroethenyl]cyclohexyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 19798791 |
| Molecular Formula | C21H26FN |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 4-[4-[4-[(E)-2-fluoroethenyl]cyclohexyl]cyclohexyl]benzonitrile |
| SMILES | N#Cc1ccc(C2CCC(C3CCC(/C=C/F)CC3)CC2)cc1 |
| InChI | InChI=1S/C21H26FN/c22-14-13-16-1-5-18(6-2-16)20-9-11-21(12-10-20)19-7-3-17(15-23)4-8-19/h3-4,7-8,13-14,16,18,20-21H,1-2,5-6,9-12H2/b14-13+ |
| InChIKey | PBEURAWZKOJCDV-BUHFOSPRSA-N |
| XLogP | 6.12 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |