C26H35NO2 — CID 19695572
4-[4-[4-[(E)-3-(1,3-dioxan-2-yl)prop-1-enyl]cyclohexyl]cyclohexyl]benzonitrile (PubChem CID 19695572) has the molecular formula C26H35NO2 and a molecular weight of 393.57 g/mol. Its IUPAC name is 4-[4-[4-[(E)-3-(1,3-dioxan-2-yl)prop-1-enyl]cyclohexyl]cyclohexyl]benzonitrile.
| Compound Name | 4-[4-[4-[(E)-3-(1,3-dioxan-2-yl)prop-1-enyl]cyclohexyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 19695572 |
| Molecular Formula | C26H35NO2 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | 4-[4-[4-[(E)-3-(1,3-dioxan-2-yl)prop-1-enyl]cyclohexyl]cyclohexyl]benzonitrile |
| SMILES | N#Cc1ccc(C2CCC(C3CCC(/C=C/CC4OCCCO4)CC3)CC2)cc1 |
| InChI | InChI=1S/C26H35NO2/c27-19-21-7-11-23(12-8-21)25-15-13-24(14-16-25)22-9-5-20(6-10-22)3-1-4-26-28-17-2-18-29-26/h1,3,7-8,11-12,20,22,24-26H,2,4-6,9-10,13-18H2/b3-1+ |
| InChIKey | AFCKUZZISAHSKZ-HNQUOIGGSA-N |
| XLogP | 6.35 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|