C24H33NO — CID 19097907
4-[4-[4-[(E)-3-ethoxyprop-1-enyl]cyclohexyl]cyclohexyl]benzonitrile (PubChem CID 19097907) has the molecular formula C24H33NO and a molecular weight of 351.53 g/mol. Its IUPAC name is 4-[4-[4-[(E)-3-ethoxyprop-1-enyl]cyclohexyl]cyclohexyl]benzonitrile.
| Compound Name | 4-[4-[4-[(E)-3-ethoxyprop-1-enyl]cyclohexyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 19097907 |
| Molecular Formula | C24H33NO |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | 4-[4-[4-[(E)-3-ethoxyprop-1-enyl]cyclohexyl]cyclohexyl]benzonitrile |
| SMILES | CCOC/C=C/C1CCC(C2CCC(c3ccc(C#N)cc3)CC2)CC1 |
| InChI | InChI=1S/C24H33NO/c1-2-26-17-3-4-19-5-9-21(10-6-19)23-13-15-24(16-14-23)22-11-7-20(18-25)8-12-22/h3-4,7-8,11-12,19,21,23-24H,2,5-6,9-10,13-17H2,1H3/b4-3+ |
| InChIKey | JCCOZQZIUHJRBK-ONEGZZNKSA-N |
| XLogP | 6.23 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|