C23H29N — CID 22915750
4-[4-[4-[(1E)-buta-1,3-dienyl]cyclohexyl]cyclohexyl]benzonitrile (PubChem CID 22915750) has the molecular formula C23H29N and a molecular weight of 319.49 g/mol. Its IUPAC name is 4-[4-[4-[(1E)-buta-1,3-dienyl]cyclohexyl]cyclohexyl]benzonitrile.
| Compound Name | 4-[4-[4-[(1E)-buta-1,3-dienyl]cyclohexyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 22915750 |
| Molecular Formula | C23H29N |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 4-[4-[4-[(1E)-buta-1,3-dienyl]cyclohexyl]cyclohexyl]benzonitrile |
| SMILES | C=C/C=C/C1CCC(C2CCC(c3ccc(C#N)cc3)CC2)CC1 |
| InChI | InChI=1S/C23H29N/c1-2-3-4-18-5-9-20(10-6-18)22-13-15-23(16-14-22)21-11-7-19(17-24)8-12-21/h2-4,7-8,11-12,18,20,22-23H,1,5-6,9-10,13-16H2/b4-3+ |
| InChIKey | KYVFAFGDAKEJNT-ONEGZZNKSA-N |
| XLogP | 6.38 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|