C19H23N — CID 20809719
4-[(4aR,6R,8aR)-6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzonitrile (PubChem CID 20809719) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 4-[(4aR,6R,8aR)-6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzonitrile.
| Compound Name | 4-[(4aR,6R,8aR)-6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 20809719 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 4-[(4aR,6R,8aR)-6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzonitrile |
| SMILES | C=C[C@@H]1CC[C@@H]2CC(c3ccc(C#N)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C19H23N/c1-2-14-3-8-19-12-18(10-9-17(19)11-14)16-6-4-15(13-20)5-7-16/h2,4-7,14,17-19H,1,3,8-12H2/t14-,17-,18?,19-/m1/s1 |
| InChIKey | XNPMEPUXQWUJAD-VPBYMLOASA-N |
| XLogP | 5.04 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|