C26H26FNO2 — CID 139869176
(4-cyanophenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-fluorobenzoate (PubChem CID 139869176) has the molecular formula C26H26FNO2 and a molecular weight of 403.50 g/mol. Its IUPAC name is (4-cyanophenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-fluorobenzoate.
| Compound Name | (4-cyanophenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-fluorobenzoate |
|---|---|
| PubChem CID | 139869176 |
| Molecular Formula | C26H26FNO2 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | (4-cyanophenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-fluorobenzoate |
| SMILES | C=CC1CCC2CC(c3ccc(C(=O)Oc4ccc(C#N)cc4)cc3F)CCC2C1 |
| InChI | InChI=1S/C26H26FNO2/c1-2-17-3-6-20-14-21(8-7-19(20)13-17)24-12-9-22(15-25(24)27)26(29)30-23-10-4-18(16-28)5-11-23/h2,4-5,9-12,15,17,19-21H,1,3,6-8,13-14H2 |
| InChIKey | CDWVVROREHQUEZ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|