C29H31F2NO2 — CID 139869452
(4-cyano-3-fluorophenyl) 3-fluoro-4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate (PubChem CID 139869452) has the molecular formula C29H31F2NO2 and a molecular weight of 463.57 g/mol. Its IUPAC name is (4-cyano-3-fluorophenyl) 3-fluoro-4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate.
| Compound Name | (4-cyano-3-fluorophenyl) 3-fluoro-4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate |
|---|---|
| PubChem CID | 139869452 |
| Molecular Formula | C29H31F2NO2 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | (4-cyano-3-fluorophenyl) 3-fluoro-4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate |
| SMILES | C/C=C/CCC1CCC2CC(c3ccc(C(=O)Oc4ccc(C#N)c(F)c4)cc3F)CCC2C1 |
| InChI | InChI=1S/C29H31F2NO2/c1-2-3-4-5-19-6-7-21-15-22(9-8-20(21)14-19)26-13-11-23(16-28(26)31)29(33)34-25-12-10-24(18-32)27(30)17-25/h2-3,10-13,16-17,19-22H,4-9,14-15H2,1H3/b3-2+ |
| InChIKey | FMHMKABDQPVZLG-NSCUHMNNSA-N |
| XLogP | 7.71 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|