C32H38F2O2 — CID 139867931
(4-but-3-enyl-2-fluorophenyl) 3-fluoro-4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate (PubChem CID 139867931) has the molecular formula C32H38F2O2 and a molecular weight of 492.65 g/mol. Its IUPAC name is (4-but-3-enyl-2-fluorophenyl) 3-fluoro-4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate.
| Compound Name | (4-but-3-enyl-2-fluorophenyl) 3-fluoro-4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate |
|---|---|
| PubChem CID | 139867931 |
| Molecular Formula | C32H38F2O2 |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | (4-but-3-enyl-2-fluorophenyl) 3-fluoro-4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate |
| SMILES | C=CCCc1ccc(OC(=O)c2ccc(C3CCC4CC(CC/C=C/C)CCC4C3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C32H38F2O2/c1-3-5-7-9-22-10-12-25-20-26(14-13-24(25)18-22)28-16-15-27(21-29(28)33)32(35)36-31-17-11-23(8-6-4-2)19-30(31)34/h3-5,11,15-17,19,21-22,24-26H,2,6-10,12-14,18,20H2,1H3/b5-3+ |
| InChIKey | JFMISYZDDTUDOS-HWKANZROSA-N |
| XLogP | 8.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|