C30H43FO — CID 139870658
2-[4-(2-fluoro-4-prop-2-enoxyphenyl)cyclohexyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139870658) has the molecular formula C30H43FO and a molecular weight of 438.67 g/mol. Its IUPAC name is 2-[4-(2-fluoro-4-prop-2-enoxyphenyl)cyclohexyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-(2-fluoro-4-prop-2-enoxyphenyl)cyclohexyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139870658 |
| Molecular Formula | C30H43FO |
| Molecular Weight | 438.67 g/mol |
| Exact Mass | 438.33 |
| IUPAC Name | 2-[4-(2-fluoro-4-prop-2-enoxyphenyl)cyclohexyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CCOc1ccc(C2CCC(C3CCC4CC(CC/C=C/C)CCC4C3)CC2)c(F)c1 |
| InChI | InChI=1S/C30H43FO/c1-3-5-6-7-22-8-9-27-20-26(15-14-25(27)19-22)23-10-12-24(13-11-23)29-17-16-28(21-30(29)31)32-18-4-2/h3-5,16-17,21-27H,2,6-15,18-20H2,1H3/b5-3+ |
| InChIKey | OMUOARRPTQVANE-HWKANZROSA-N |
| XLogP | 8.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.67 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|