C31H42F2O3 — CID 139866638
(3,5-difluoro-4-prop-2-enoxyphenyl) 4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexane-1-carboxylate (PubChem CID 139866638) has the molecular formula C31H42F2O3 and a molecular weight of 500.67 g/mol. Its IUPAC name is (3,5-difluoro-4-prop-2-enoxyphenyl) 4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexane-1-carboxylate.
| Compound Name | (3,5-difluoro-4-prop-2-enoxyphenyl) 4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139866638 |
| Molecular Formula | C31H42F2O3 |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | (3,5-difluoro-4-prop-2-enoxyphenyl) 4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexane-1-carboxylate |
| SMILES | C=CCOc1c(F)cc(OC(=O)C2CCC(C3CCC4CC(CC/C=C/C)CCC4C3)CC2)cc1F |
| InChI | InChI=1S/C31H42F2O3/c1-3-5-6-7-21-8-9-26-18-25(15-14-24(26)17-21)22-10-12-23(13-11-22)31(34)36-27-19-28(32)30(29(33)20-27)35-16-4-2/h3-5,19-26H,2,6-18H2,1H3/b5-3+ |
| InChIKey | RIVQORGPJKMHES-HWKANZROSA-N |
| XLogP | 8.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|