C30H42F2O3 — CID 139869482
[4-[(E)-but-2-enoxy]-3,5-difluorophenyl] 6-(4-propylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 139869482) has the molecular formula C30H42F2O3 and a molecular weight of 488.66 g/mol. Its IUPAC name is [4-[(E)-but-2-enoxy]-3,5-difluorophenyl] 6-(4-propylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | [4-[(E)-but-2-enoxy]-3,5-difluorophenyl] 6-(4-propylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139869482 |
| Molecular Formula | C30H42F2O3 |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | [4-[(E)-but-2-enoxy]-3,5-difluorophenyl] 6-(4-propylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | C/C=C/COc1c(F)cc(OC(=O)C2CCCC3CC(C4CCC(CCC)CC4)CCC32)cc1F |
| InChI | InChI=1S/C30H42F2O3/c1-3-5-16-34-29-27(31)18-24(19-28(29)32)35-30(33)26-9-6-8-23-17-22(14-15-25(23)26)21-12-10-20(7-4-2)11-13-21/h3,5,18-23,25-26H,4,6-17H2,1-2H3/b5-3+ |
| InChIKey | ZNYULPOMWRDRKV-HWKANZROSA-N |
| XLogP | 8.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|