C31H44F2O3 — CID 139866578
[4-[(E)-but-2-enoxy]-3,5-difluorophenyl] 6-(4-butylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 139866578) has the molecular formula C31H44F2O3 and a molecular weight of 502.69 g/mol. Its IUPAC name is [4-[(E)-but-2-enoxy]-3,5-difluorophenyl] 6-(4-butylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | [4-[(E)-but-2-enoxy]-3,5-difluorophenyl] 6-(4-butylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139866578 |
| Molecular Formula | C31H44F2O3 |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | [4-[(E)-but-2-enoxy]-3,5-difluorophenyl] 6-(4-butylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | C/C=C/COc1c(F)cc(OC(=O)C2CCCC3CC(C4CCC(CCCC)CC4)CCC32)cc1F |
| InChI | InChI=1S/C31H44F2O3/c1-3-5-8-21-11-13-22(14-12-21)23-15-16-26-24(18-23)9-7-10-27(26)31(34)36-25-19-28(32)30(29(33)20-25)35-17-6-4-2/h4,6,19-24,26-27H,3,5,7-18H2,1-2H3/b6-4+ |
| InChIKey | YFJHMSCOUOOGMW-GQCTYLIASA-N |
| XLogP | 8.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|