C30H43FO3 — CID 139868310
(2-fluoro-4-prop-2-enoxyphenyl) 6-(4-butylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 139868310) has the molecular formula C30H43FO3 and a molecular weight of 470.67 g/mol. Its IUPAC name is (2-fluoro-4-prop-2-enoxyphenyl) 6-(4-butylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | (2-fluoro-4-prop-2-enoxyphenyl) 6-(4-butylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139868310 |
| Molecular Formula | C30H43FO3 |
| Molecular Weight | 470.67 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | (2-fluoro-4-prop-2-enoxyphenyl) 6-(4-butylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | C=CCOc1ccc(OC(=O)C2CCCC3CC(C4CCC(CCCC)CC4)CCC32)c(F)c1 |
| InChI | InChI=1S/C30H43FO3/c1-3-5-7-21-10-12-22(13-11-21)23-14-16-26-24(19-23)8-6-9-27(26)30(32)34-29-17-15-25(20-28(29)31)33-18-4-2/h4,15,17,20-24,26-27H,2-3,5-14,16,18-19H2,1H3 |
| InChIKey | KTMWONUDVUKHMW-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.67 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|