C29H43FO3 — CID 139869232
(3-fluoro-4-methoxyphenyl) 6-(4-pentylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 139869232) has the molecular formula C29H43FO3 and a molecular weight of 458.66 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl) 6-(4-pentylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | (3-fluoro-4-methoxyphenyl) 6-(4-pentylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139869232 |
| Molecular Formula | C29H43FO3 |
| Molecular Weight | 458.66 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl) 6-(4-pentylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | CCCCCC1CCC(C2CCC3C(CCCC3C(=O)Oc3ccc(OC)c(F)c3)C2)CC1 |
| InChI | InChI=1S/C29H43FO3/c1-3-4-5-7-20-10-12-21(13-11-20)22-14-16-25-23(18-22)8-6-9-26(25)29(31)33-24-15-17-28(32-2)27(30)19-24/h15,17,19-23,25-26H,3-14,16,18H2,1-2H3 |
| InChIKey | UTKZZSRVBQAHGP-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.66 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|