C29H41NO2 — CID 139870256
(4-cyanophenyl) 6-(4-pentylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 139870256) has the molecular formula C29H41NO2 and a molecular weight of 435.65 g/mol. Its IUPAC name is (4-cyanophenyl) 6-(4-pentylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | (4-cyanophenyl) 6-(4-pentylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139870256 |
| Molecular Formula | C29H41NO2 |
| Molecular Weight | 435.65 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | (4-cyanophenyl) 6-(4-pentylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | CCCCCC1CCC(C2CCC3C(CCCC3C(=O)Oc3ccc(C#N)cc3)C2)CC1 |
| InChI | InChI=1S/C29H41NO2/c1-2-3-4-6-21-9-13-23(14-10-21)24-15-18-27-25(19-24)7-5-8-28(27)29(31)32-26-16-11-22(20-30)12-17-26/h11-12,16-17,21,23-25,27-28H,2-10,13-15,18-19H2,1H3 |
| InChIKey | FUBGDWWKLQBRRJ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.65 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|