C26H33NO2 — CID 139868090
(4-cyanophenyl) 6-(4-ethenylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 139868090) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is (4-cyanophenyl) 6-(4-ethenylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | (4-cyanophenyl) 6-(4-ethenylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139868090 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | (4-cyanophenyl) 6-(4-ethenylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | C=CC1CCC(C2CCC3C(CCCC3C(=O)Oc3ccc(C#N)cc3)C2)CC1 |
| InChI | InChI=1S/C26H33NO2/c1-2-18-6-10-20(11-7-18)21-12-15-24-22(16-21)4-3-5-25(24)26(28)29-23-13-8-19(17-27)9-14-23/h2,8-9,13-14,18,20-22,24-25H,1,3-7,10-12,15-16H2 |
| InChIKey | QLUHLBYDBPYWPQ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|