C25H33ClO2 — CID 139868966
(4-chlorophenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate (PubChem CID 139868966) has the molecular formula C25H33ClO2 and a molecular weight of 400.99 g/mol. Its IUPAC name is (4-chlorophenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate.
| Compound Name | (4-chlorophenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139868966 |
| Molecular Formula | C25H33ClO2 |
| Molecular Weight | 400.99 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (4-chlorophenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
| SMILES | C=CC1CCC2CC(C3CCC(C(=O)Oc4ccc(Cl)cc4)CC3)CCC2C1 |
| InChI | InChI=1S/C25H33ClO2/c1-2-17-3-4-22-16-21(10-9-20(22)15-17)18-5-7-19(8-6-18)25(27)28-24-13-11-23(26)12-14-24/h2,11-14,17-22H,1,3-10,15-16H2 |
| InChIKey | CBVYYZHAHDUWDY-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.99 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|